Description
S5700-28C-EI-24S appearance and structure

| 1. Twenty 100/1000BASE-X ports | 6. ESD jack |
| 2. Four combo ports (10/100/1000BASE-T + 100/1000BASE-X) | 7. Rear card slot |
| 3. One console port | 8. Fan slot |
| 4. One ETH management port | 9. Power module slot 2 |
| 5. Front card slot | 10. Power module slot 1 |
S5700-28C-EI-24S Datasheet
| Item | S5700-28C-EI-24S |
| Fixed port | 24 Gig SFP, 4 of which are dual-purpose 10/100/1000 or SFP ports |
| Extended slot | Provide two extended slots, one for an uplink subcard and the other for a stack card. |
| Forwarding performance | 96 Mpps |
| VLAN | 4K VLANs |
| Guest VLAN and voice VLAN | |
| VLAN assignment based on MAC addresses, protocols, IP subnets, policies, and ports | |
| 1:1 and N:1 VLAN Mapping | |
| SuperVLAN(supported by the S5700-SI/S5700-EI/S5700-HI series) | |
| Reliability | RRPP ring topology and RRPP multi-instance |
| Smart Link tree topology and Smart Link multi-instance, providing the millisecond-level protection switchover | |
| SEP | |
| ERPS(G.8032)(supported by the S5700-LI/S5700-SI/S5700-EI/S5700-HI series) | |
| STP, RSTP, and MSTP | |
| BPDU protection, root protection, and loop protection | |
| E-Trunk | |
| BFD for OSPF, BFD for IS-IS, BFD for VRRP, and BFD for PIM | |
| IP routing | Static routing |
| RIPv1, RIPv2 and RIPng, ECMP(supported by the S5700-SI/S5700-EI/S5700-HI series) | |
| OSPF, OSPFv3, IS-IS, IS-ISv6, BGP and BGP4+ (supported by the S5700-EI/S5700-HI series) | |
| IPv6 features | Neighbor Discovery (ND) |
| Path MTU (PMTU) | |
| IPv6 ping, IPv6 tracert, and IPv6 Telnet | |
| ACLs based on the source IPv6 address, destination IPv6 address, Layer 4 ports, or protocol type | |
| MLD v1/v2 snooping | |
| 6to4 tunnel, ISATAP tunnel, and manually configured tunnel | |
| Multicast | IGMP v1/v2/v3 snooping and IGMP fast leave |
| Multicast forwarding in a VLAN and multicast replication between VLANs | |
| Multicast load balancing among member ports of a trunk | |
| Controllable multicast | |
| Port-based multicast traffic statistics | |
| IGMP v1/v2/v3, PIM-SM, PIM-DM, PIM-SSM, MSDP (supported by the S5700-EI/S5700-HI series) | |
| QoS/ACL | Rate limiting on packets sent and received by an interface |
| Packet redirection | |
| Port-based traffic policing and two-rate three-color CAR | |
| Eight queues on each port | |
| WRR, DRR, SP, WRR+SP, and DRR+SP queue scheduling algorithms | |
| WRED (supported by the S5710-EI and S5700-HI) | |
| Re-marking of the 802.1p priority and DSCP priority | |
| Packet filtering at Layers 2 through 4, filtering out invalid frames based on the source MAC address, destination MAC address, source IP address, destination IP address, port number, protocol type, and VLAN ID | |
| Rate limiting in each queue and traffic shaping on ports | |
| Security | User privilege management and password protection |
| DoS attack defense, ARP attack defense, and ICMP attack defense | |
| Binding of the IP address, MAC address, interface, and VLAN | |
| Port isolation, port security, and sticky MAC | |
| MFF | |
| Blackhole MAC address entries | |
| Limit on the number of learned MAC addresses | |
| 802.1x authentication and limit on the number of users on an interface | |
| AAA authentication, RADIUS authentication, HWTACACS authentication, and NAC | |
| SSH v2.0 | |
| Hypertext Transfer Protocol Secure (HTTPS) | |
| CPU defense | |
| Blacklist and whitelist | |
| OAM | Supports |
| Access Security | DHCP Relay, DHCP Server, DHCP Snooping, DHCP Security |
| Management and maintenance | Virtual cable test |
| Stacking | |
| MAC Forced Forwarding (MFF) | |
| Port mirroring and RSPAN (remote port mirroring) | |
| Remote configuration and maintenance using Telnet | |
| SNMP v1/v2/v3 | |
| RMON | |
| Web NMS | |
| HGMP | |
| System logs and alarms of different levels | |
| 802.3az EEE (supported by the S5700(S)-LI, S5710-EI, S5700-HI and S5710-HI) | |
| GVRP | |
| MUX VLAN | |
| NetStream (supported by the S5710-EI, S5700-HI and S5710-HI) | |
| sFlow(supported by the S5700(S)-LI/S5700-EI/S5700-HI series) | |
| Interoperability | Supports VBST (Compatible with PVST/PVST+/RPVST) |
| Supports LNP (Similar to DTP) | |
| Supports VCMP (Similar to VTP) | |
| DDR memory | 256 MB |
| Flash memory | 32 MB |
| Mean time between failures (MTBF) | S5700-28C-EI-24S: 52.80 years when no card is configured; 41.33 years when a 2x10GE card is configured; 50.00 years when a 4xGE front card is configured; 26.52 years when a 4x10GE front card is configured |
| Mean time to repair (MTTR) | 2 hours |
| Availability | > 0.99999 |
| Surge protection: Service port protection | Non-PoE switch: ±2 kV in common mode |
| Surge protection: Power supply protection | Non-PoE switch: |
| AC: ±6 kV in differential mode; ±6 kV in common mode | |
| DC: ±1 kV in differential mode; ±2 kV in common mode | |
| Stack port | Two stack ports available on each stack card |
| Maximum stack bandwidth (bidirectional) | 48 Gbit/s |
| RPS | Not supported |
| PoE | The PWR series support PoE. |
| Input DC voltage: Rated input voltage range | -48 V DC to -60 V DC |
| Input DC voltage: Maximum voltage range | -36 V DC to -72 V DC |
| Input AC voltage: Rated input voltage range | 100 V AC to 240 V AC, 50/60 Hz |
| Input AC voltage: Maximum voltage range | 90 V AC to 264 V AC, 47 Hz to 63 Hz |
| Maximum system power consumption (100% throughput, 100% PoE loads, full speed of fans) | S5700-28C-EI-24S: 63 W |
| Operating temperature | 0°C to 50°C |
| Storage temperature | -40°C to +70°C |
| Noise under normal temperature (27°C, sound power) | S5700-28C-EI: less than 41 dBA |
| Relative humidity | 5% RH to 95% RH, noncondensing |
| Operating altitude | Non-PoE switch: |
| AC: 0 m to 5000 m | |
| DC: 0 m to 2000 m | |
| PoE switch: 0 m to 5000 m | |
| EMC | CISPR22 Class A |
| CISPR24 | |
| EN55022 Class A | |
| EN50024 | |
| ETSI EN 300 386 Class A | |
| CFR 47 FCC Part 15 Class A | |
| ICES 003 Class A | |
| AS/NZS CISPR22 Class A | |
| IEC61000-4-2 | |
| ITU-T K 20 | |
| ITU-T K 44 | |
| Environmental standards | RoHS |
| REACH | |
| WEEE | |
| Security | IEC 60950-1 |
| EN 60950-1/A11/A12 | |
| UL 60950-1 | |
| CSA C22.2 No 60950-1 | |
| AS/NZS 60950.1 | |
| Laser safety | IEC60825-1 |
| IEC60825-2 | |
| EN60825-1 | |
| EN60825-2 | |
| Dimensions (W x D x H) | 442.0 mm x 420.0 mm x 43.6 mm |
| Fully loaded | ≤ 8.5 kg |
| Empty loaded | ≤ 5 kg |












Celso –
Después de comunicarse con el equipo de telecomate.com, me recomendaron esta serie S5700. Compré 10 unidades para expansión, todas las cuales son nuevas y originales Huawei, funcionan muy bien.